C19H26N2O7S — CID 10526456
(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 10526456) has the molecular formula C19H26N2O7S and a molecular weight of 426.49 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 10526456 |
| Molecular Formula | C19H26N2O7S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)OCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H26N2O7S/c1-19(2,3)28-18(24)20-12-8-4-5-11-16(22)27-13-21-17(23)14-9-6-7-10-15(14)29(21,25)26/h6-7,9-10H,4-5,8,11-13H2,1-3H3,(H,20,24) |
| InChIKey | AGPHENLELATUSD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|