C16H26N2O3S — CID 83935952
tert-butyl N-[4-amino-1-hydroxy-1-(4-methylsulfanylphenyl)butan-2-yl]carbamate (PubChem CID 83935952) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is tert-butyl N-[4-amino-1-hydroxy-1-(4-methylsulfanylphenyl)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-amino-1-hydroxy-1-(4-methylsulfanylphenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 83935952 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl N-[4-amino-1-hydroxy-1-(4-methylsulfanylphenyl)butan-2-yl]carbamate |
| SMILES | CSc1ccc(C(O)C(CCN)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-16(2,3)21-15(20)18-13(9-10-17)14(19)11-5-7-12(22-4)8-6-11/h5-8,13-14,19H,9-10,17H2,1-4H3,(H,18,20) |
| InChIKey | MLPJWXVTHZQXDS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |