C15H20O4S — CID 73011253
4-[(2-methylpropan-2-yl)oxy]-3-(4-methylsulfanylphenyl)-4-oxobutanoic acid (PubChem CID 73011253) has the molecular formula C15H20O4S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxy]-3-(4-methylsulfanylphenyl)-4-oxobutanoic acid.
| Compound Name | 4-[(2-methylpropan-2-yl)oxy]-3-(4-methylsulfanylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 73011253 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxy]-3-(4-methylsulfanylphenyl)-4-oxobutanoic acid |
| SMILES | CSc1ccc(C(CC(=O)O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H20O4S/c1-15(2,3)19-14(18)12(9-13(16)17)10-5-7-11(20-4)8-6-10/h5-8,12H,9H2,1-4H3,(H,16,17) |
| InChIKey | NMPCGNSJYHKNAO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |