C28H32O2S2 — CID 11225065
tert-butyl 2-phenyl-6,6-bis(phenylsulfanyl)hexanoate (PubChem CID 11225065) has the molecular formula C28H32O2S2 and a molecular weight of 464.70 g/mol. Its IUPAC name is tert-butyl 2-phenyl-6,6-bis(phenylsulfanyl)hexanoate.
| Compound Name | tert-butyl 2-phenyl-6,6-bis(phenylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 11225065 |
| Molecular Formula | C28H32O2S2 |
| Molecular Weight | 464.70 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | tert-butyl 2-phenyl-6,6-bis(phenylsulfanyl)hexanoate |
| SMILES | CC(C)(C)OC(=O)C(CCCC(Sc1ccccc1)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O2S2/c1-28(2,3)30-27(29)25(22-14-7-4-8-15-22)20-13-21-26(31-23-16-9-5-10-17-23)32-24-18-11-6-12-19-24/h4-12,14-19,25-26H,13,20-21H2,1-3H3 |
| InChIKey | WGJFXDLTSZPIHC-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|