C19H21FN2O4 — CID 167608026
tert-butyl N-[1-[4-(5-fluoro-6-oxo-1H-pyridin-3-yl)phenyl]-3-oxopropyl]carbamate (PubChem CID 167608026) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(5-fluoro-6-oxo-1H-pyridin-3-yl)phenyl]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(5-fluoro-6-oxo-1H-pyridin-3-yl)phenyl]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 167608026 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | tert-butyl N-[1-[4-(5-fluoro-6-oxo-1H-pyridin-3-yl)phenyl]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC=O)c1ccc(-c2c[nH]c(=O)c(F)c2)cc1 |
| InChI | InChI=1S/C19H21FN2O4/c1-19(2,3)26-18(25)22-16(8-9-23)13-6-4-12(5-7-13)14-10-15(20)17(24)21-11-14/h4-7,9-11,16H,8H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | KQONIEVCLCSRMZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|