C15H17Cl4NO4 — CID 10598033
diethyl 2-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]propanedioate (PubChem CID 10598033) has the molecular formula C15H17Cl4NO4 and a molecular weight of 417.12 g/mol. Its IUPAC name is diethyl 2-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]propanedioate.
| Compound Name | diethyl 2-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]propanedioate |
|---|---|
| PubChem CID | 10598033 |
| Molecular Formula | C15H17Cl4NO4 |
| Molecular Weight | 417.12 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | diethyl 2-[2,2,2-trichloro-1-(4-chloroanilino)ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(Nc1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H17Cl4NO4/c1-3-23-13(21)11(14(22)24-4-2)12(15(17,18)19)20-10-7-5-9(16)6-8-10/h5-8,11-12,20H,3-4H2,1-2H3 |
| InChIKey | XZXXDTWZVQQRBC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.12 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|