C18H21BrN4O4S — CID 135059080
(2S,3S)-3-azido-2-bromo-1-(3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-(4-methoxyphenyl)propan-1-one (PubChem CID 135059080) has the molecular formula C18H21BrN4O4S and a molecular weight of 469.36 g/mol. Its IUPAC name is (2S,3S)-3-azido-2-bromo-1-(3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | (2S,3S)-3-azido-2-bromo-1-(3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 135059080 |
| Molecular Formula | C18H21BrN4O4S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | (2S,3S)-3-azido-2-bromo-1-(3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl)-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc([C@H](N=[N+]=[N-])[C@H](Br)C(=O)N2C3CC4CCC3(C4)CS2(=O)=O)cc1 |
| InChI | InChI=1S/C18H21BrN4O4S/c1-27-13-4-2-12(3-5-13)16(21-22-20)15(19)17(24)23-14-8-11-6-7-18(14,9-11)10-28(23,25)26/h2-5,11,14-16H,6-10H2,1H3/t11?,14?,15-,16-,18?/m0/s1 |
| InChIKey | KXGQDBCALFSVDU-MAUWXVCCSA-N |
| XLogP | 3.54 |
| TPSA | 112.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|