C24H34O3 — CID 174638815
7-(1-bicyclo[2.2.1]heptanyl)-3-(4-methoxyphenyl)-2-propylhept-5-enoic acid (PubChem CID 174638815) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is 7-(1-bicyclo[2.2.1]heptanyl)-3-(4-methoxyphenyl)-2-propylhept-5-enoic acid.
| Compound Name | 7-(1-bicyclo[2.2.1]heptanyl)-3-(4-methoxyphenyl)-2-propylhept-5-enoic acid |
|---|---|
| PubChem CID | 174638815 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 7-(1-bicyclo[2.2.1]heptanyl)-3-(4-methoxyphenyl)-2-propylhept-5-enoic acid |
| SMILES | CCCC(C(=O)O)C(CC=CCC12CCC(CC1)C2)c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H34O3/c1-3-6-22(23(25)26)21(19-8-10-20(27-2)11-9-19)7-4-5-14-24-15-12-18(17-24)13-16-24/h4-5,8-11,18,21-22H,3,6-7,12-17H2,1-2H3,(H,25,26) |
| InChIKey | NYHFBQIYWKDJEC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|