C23H31BrO2 — CID 174650758
7-(1-bicyclo[2.2.1]heptanyl)-3-(4-bromophenyl)-2-propylhept-5-enoic acid (PubChem CID 174650758) has the molecular formula C23H31BrO2 and a molecular weight of 419.40 g/mol. Its IUPAC name is 7-(1-bicyclo[2.2.1]heptanyl)-3-(4-bromophenyl)-2-propylhept-5-enoic acid.
| Compound Name | 7-(1-bicyclo[2.2.1]heptanyl)-3-(4-bromophenyl)-2-propylhept-5-enoic acid |
|---|---|
| PubChem CID | 174650758 |
| Molecular Formula | C23H31BrO2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 7-(1-bicyclo[2.2.1]heptanyl)-3-(4-bromophenyl)-2-propylhept-5-enoic acid |
| SMILES | CCCC(C(=O)O)C(CC=CCC12CCC(CC1)C2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H31BrO2/c1-2-5-21(22(25)26)20(18-7-9-19(24)10-8-18)6-3-4-13-23-14-11-17(16-23)12-15-23/h3-4,7-10,17,20-21H,2,5-6,11-16H2,1H3,(H,25,26) |
| InChIKey | WSPIWRIVPPMYMK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|