C21H25F2N3O5 — CID 45112553
(2S,3S,5R)-2-azido-1-(3,5-difluorophenoxy)-5-methoxy-6-[(3-methoxyphenyl)methoxy]hexan-3-ol (PubChem CID 45112553) has the molecular formula C21H25F2N3O5 and a molecular weight of 437.44 g/mol. Its IUPAC name is (2S,3S,5R)-2-azido-1-(3,5-difluorophenoxy)-5-methoxy-6-[(3-methoxyphenyl)methoxy]hexan-3-ol.
| Compound Name | (2S,3S,5R)-2-azido-1-(3,5-difluorophenoxy)-5-methoxy-6-[(3-methoxyphenyl)methoxy]hexan-3-ol |
|---|---|
| PubChem CID | 45112553 |
| Molecular Formula | C21H25F2N3O5 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (2S,3S,5R)-2-azido-1-(3,5-difluorophenoxy)-5-methoxy-6-[(3-methoxyphenyl)methoxy]hexan-3-ol |
| SMILES | COc1cccc(COC[C@@H](C[C@H](O)[C@H](COc2cc(F)cc(F)c2)N=[N+]=[N-])OC)c1 |
| InChI | InChI=1S/C21H25F2N3O5/c1-28-17-5-3-4-14(6-17)11-30-12-19(29-2)10-21(27)20(25-26-24)13-31-18-8-15(22)7-16(23)9-18/h3-9,19-21,27H,10-13H2,1-2H3/t19-,20+,21+/m1/s1 |
| InChIKey | JICORNCJXOVURZ-HKBOAZHASA-N |
| XLogP | 4.01 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|