C19H22F2N4O3 — CID 45112663
(2S,3S,5R)-6-anilino-2-azido-1-(3,5-difluorophenoxy)-5-methoxyhexan-3-ol (PubChem CID 45112663) has the molecular formula C19H22F2N4O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is (2S,3S,5R)-6-anilino-2-azido-1-(3,5-difluorophenoxy)-5-methoxyhexan-3-ol.
| Compound Name | (2S,3S,5R)-6-anilino-2-azido-1-(3,5-difluorophenoxy)-5-methoxyhexan-3-ol |
|---|---|
| PubChem CID | 45112663 |
| Molecular Formula | C19H22F2N4O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2S,3S,5R)-6-anilino-2-azido-1-(3,5-difluorophenoxy)-5-methoxyhexan-3-ol |
| SMILES | CO[C@@H](CNc1ccccc1)C[C@H](O)[C@H](COc1cc(F)cc(F)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C19H22F2N4O3/c1-27-17(11-23-15-5-3-2-4-6-15)10-19(26)18(24-25-22)12-28-16-8-13(20)7-14(21)9-16/h2-9,17-19,23,26H,10-12H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | BPYRHZQTYCJYPM-QYZOEREBSA-N |
| XLogP | 3.90 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|