C19H19F3N4O4 — CID 45104921
(2R,4S,5S)-5-azido-6-(3,5-difluorophenoxy)-N-(4-fluorophenyl)-4-hydroxy-2-methoxyhexanamide (PubChem CID 45104921) has the molecular formula C19H19F3N4O4 and a molecular weight of 424.38 g/mol. Its IUPAC name is (2R,4S,5S)-5-azido-6-(3,5-difluorophenoxy)-N-(4-fluorophenyl)-4-hydroxy-2-methoxyhexanamide.
| Compound Name | (2R,4S,5S)-5-azido-6-(3,5-difluorophenoxy)-N-(4-fluorophenyl)-4-hydroxy-2-methoxyhexanamide |
|---|---|
| PubChem CID | 45104921 |
| Molecular Formula | C19H19F3N4O4 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (2R,4S,5S)-5-azido-6-(3,5-difluorophenoxy)-N-(4-fluorophenyl)-4-hydroxy-2-methoxyhexanamide |
| SMILES | CO[C@H](C[C@H](O)[C@H](COc1cc(F)cc(F)c1)N=[N+]=[N-])C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F3N4O4/c1-29-18(19(28)24-14-4-2-11(20)3-5-14)9-17(27)16(25-26-23)10-30-15-7-12(21)6-13(22)8-15/h2-8,16-18,27H,9-10H2,1H3,(H,24,28)/t16-,17-,18+/m0/s1 |
| InChIKey | WNIJAIWUPAZJAA-OKZBNKHCSA-N |
| XLogP | 3.57 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|