C23H30FN3O4 — CID 142843469
N-[2-amino-5-(4-fluoroanilino)-4-methyl-5-oxopentyl]-3,5-diethoxybenzamide (PubChem CID 142843469) has the molecular formula C23H30FN3O4 and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[2-amino-5-(4-fluoroanilino)-4-methyl-5-oxopentyl]-3,5-diethoxybenzamide.
| Compound Name | N-[2-amino-5-(4-fluoroanilino)-4-methyl-5-oxopentyl]-3,5-diethoxybenzamide |
|---|---|
| PubChem CID | 142843469 |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | N-[2-amino-5-(4-fluoroanilino)-4-methyl-5-oxopentyl]-3,5-diethoxybenzamide |
| SMILES | CCOc1cc(OCC)cc(C(=O)NCC(N)CC(C)C(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H30FN3O4/c1-4-30-20-11-16(12-21(13-20)31-5-2)23(29)26-14-18(25)10-15(3)22(28)27-19-8-6-17(24)7-9-19/h6-9,11-13,15,18H,4-5,10,14,25H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | QVIXDMRGBYMMBI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |