C12H14F3NO3 — CID 138985988
methyl 2-amino-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoate (PubChem CID 138985988) has the molecular formula C12H14F3NO3 and a molecular weight of 277.24 g/mol. Its IUPAC name is methyl 2-amino-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 138985988 |
| Molecular Formula | C12H14F3NO3 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | methyl 2-amino-3-[3-(2,2,2-trifluoroethoxy)phenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1cccc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO3/c1-18-11(17)10(16)6-8-3-2-4-9(5-8)19-7-12(13,14)15/h2-5,10H,6-7,16H2,1H3 |
| InChIKey | RTEBBBMBGBBNAO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |