C13H5F5N2O7S — CID 22708913
(2,6-dinitrophenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 22708913) has the molecular formula C13H5F5N2O7S and a molecular weight of 428.25 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | (2,6-dinitrophenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 22708913 |
| Molecular Formula | C13H5F5N2O7S |
| Molecular Weight | 428.25 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | (2,6-dinitrophenyl)methyl 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1COS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H5F5N2O7S/c14-8-9(15)11(17)13(12(18)10(8)16)28(25,26)27-4-5-6(19(21)22)2-1-3-7(5)20(23)24/h1-3H,4H2 |
| InChIKey | JAUBOYSXRVPBJW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|