C25H17F3N2O5Si — CID 22168290
(2,6-dinitrophenyl)methoxy-tris(4-fluorophenyl)silane (PubChem CID 22168290) has the molecular formula C25H17F3N2O5Si and a molecular weight of 510.50 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methoxy-tris(4-fluorophenyl)silane.
| Compound Name | (2,6-dinitrophenyl)methoxy-tris(4-fluorophenyl)silane |
|---|---|
| PubChem CID | 22168290 |
| Molecular Formula | C25H17F3N2O5Si |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | (2,6-dinitrophenyl)methoxy-tris(4-fluorophenyl)silane |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1CO[Si](c1ccc(F)cc1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H17F3N2O5Si/c26-17-4-10-20(11-5-17)36(21-12-6-18(27)7-13-21,22-14-8-19(28)9-15-22)35-16-23-24(29(31)32)2-1-3-25(23)30(33)34/h1-15H,16H2 |
| InChIKey | ALQSIUMJXWFXFT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|