C25H18F3NO3Si — CID 57036722
(2-nitrophenyl)methoxy-diphenyl-(2,4,5-trifluorophenyl)silane (PubChem CID 57036722) has the molecular formula C25H18F3NO3Si and a molecular weight of 465.50 g/mol. Its IUPAC name is (2-nitrophenyl)methoxy-diphenyl-(2,4,5-trifluorophenyl)silane.
| Compound Name | (2-nitrophenyl)methoxy-diphenyl-(2,4,5-trifluorophenyl)silane |
|---|---|
| PubChem CID | 57036722 |
| Molecular Formula | C25H18F3NO3Si |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | (2-nitrophenyl)methoxy-diphenyl-(2,4,5-trifluorophenyl)silane |
| SMILES | O=[N+]([O-])c1ccccc1CO[Si](c1ccccc1)(c1ccccc1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C25H18F3NO3Si/c26-21-15-23(28)25(16-22(21)27)33(19-10-3-1-4-11-19,20-12-5-2-6-13-20)32-17-18-9-7-8-14-24(18)29(30)31/h1-16H,17H2 |
| InChIKey | SDUCYHZZBXYCPQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|