C14H12F2N2O3 — CID 79880994
[3,5-difluoro-4-[(2-nitrophenyl)methoxy]phenyl]methanamine (PubChem CID 79880994) has the molecular formula C14H12F2N2O3 and a molecular weight of 294.26 g/mol. Its IUPAC name is [3,5-difluoro-4-[(2-nitrophenyl)methoxy]phenyl]methanamine.
| Compound Name | [3,5-difluoro-4-[(2-nitrophenyl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 79880994 |
| Molecular Formula | C14H12F2N2O3 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [3,5-difluoro-4-[(2-nitrophenyl)methoxy]phenyl]methanamine |
| SMILES | NCc1cc(F)c(OCc2ccccc2[N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C14H12F2N2O3/c15-11-5-9(7-17)6-12(16)14(11)21-8-10-3-1-2-4-13(10)18(19)20/h1-6H,7-8,17H2 |
| InChIKey | HUMSFFZPNKTHLA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|