C17H5F7N2O7S — CID 20671192
(2,6-dinitrophenyl)methyl 2,3,4,5,6,7,8-heptafluoronaphthalene-1-sulfonate (PubChem CID 20671192) has the molecular formula C17H5F7N2O7S and a molecular weight of 514.29 g/mol. Its IUPAC name is (2,6-dinitrophenyl)methyl 2,3,4,5,6,7,8-heptafluoronaphthalene-1-sulfonate.
| Compound Name | (2,6-dinitrophenyl)methyl 2,3,4,5,6,7,8-heptafluoronaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 20671192 |
| Molecular Formula | C17H5F7N2O7S |
| Molecular Weight | 514.29 g/mol |
| Exact Mass | 513.97 |
| IUPAC Name | (2,6-dinitrophenyl)methyl 2,3,4,5,6,7,8-heptafluoronaphthalene-1-sulfonate |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1COS(=O)(=O)c1c(F)c(F)c(F)c2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C17H5F7N2O7S/c18-10-8-9(12(20)14(22)13(10)21)17(16(24)15(23)11(8)19)34(31,32)33-4-5-6(25(27)28)2-1-3-7(5)26(29)30/h1-3H,4H2 |
| InChIKey | LPWJGNDZPWDHHJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|