C13H8F3NO5S — CID 59550483
(2-fluoro-6-nitrophenyl)methyl 2,6-difluorobenzenesulfonate (PubChem CID 59550483) has the molecular formula C13H8F3NO5S and a molecular weight of 347.27 g/mol. Its IUPAC name is (2-fluoro-6-nitrophenyl)methyl 2,6-difluorobenzenesulfonate.
| Compound Name | (2-fluoro-6-nitrophenyl)methyl 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 59550483 |
| Molecular Formula | C13H8F3NO5S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (2-fluoro-6-nitrophenyl)methyl 2,6-difluorobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(F)c1COS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H8F3NO5S/c14-9-3-2-6-12(17(18)19)8(9)7-22-23(20,21)13-10(15)4-1-5-11(13)16/h1-6H,7H2 |
| InChIKey | AFDJMXVRRCPURU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|