C18H8F5IN2O7S — CID 141235210
[bis(3-nitrophenyl)-λ3-iodanyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 141235210) has the molecular formula C18H8F5IN2O7S and a molecular weight of 618.23 g/mol. Its IUPAC name is [bis(3-nitrophenyl)-λ3-iodanyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [bis(3-nitrophenyl)-λ3-iodanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 141235210 |
| Molecular Formula | C18H8F5IN2O7S |
| Molecular Weight | 618.23 g/mol |
| Exact Mass | 617.90 |
| IUPAC Name | [bis(3-nitrophenyl)-λ3-iodanyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | O=[N+]([O-])c1cccc(I(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H8F5IN2O7S/c19-13-14(20)16(22)18(17(23)15(13)21)34(31,32)33-24(9-3-1-5-11(7-9)25(27)28)10-4-2-6-12(8-10)26(29)30/h1-8H |
| InChIKey | GDTHJLGFZIHSKD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.23 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|