C10H4F6INO6 — CID 11569105
[(3-nitrophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 11569105) has the molecular formula C10H4F6INO6 and a molecular weight of 475.04 g/mol. Its IUPAC name is [(3-nitrophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [(3-nitrophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11569105 |
| Molecular Formula | C10H4F6INO6 |
| Molecular Weight | 475.04 g/mol |
| Exact Mass | 474.90 |
| IUPAC Name | [(3-nitrophenyl)-(2,2,2-trifluoroacetyl)oxy-lambda3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OI(OC(=O)C(F)(F)F)c1cccc([N+](=O)[O-])c1)C(F)(F)F |
| InChI | InChI=1S/C10H4F6INO6/c11-9(12,13)7(19)23-17(24-8(20)10(14,15)16)5-2-1-3-6(4-5)18(21)22/h1-4H |
| InChIKey | VAQZLAXFVYOFLA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|