C19H35N3O5Si — CID 71286463
N-[(2S)-1-butoxy-3-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methoxy-3-nitropyridin-2-amine (PubChem CID 71286463) has the molecular formula C19H35N3O5Si and a molecular weight of 413.59 g/mol. Its IUPAC name is N-[(2S)-1-butoxy-3-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methoxy-3-nitropyridin-2-amine.
| Compound Name | N-[(2S)-1-butoxy-3-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methoxy-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 71286463 |
| Molecular Formula | C19H35N3O5Si |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[(2S)-1-butoxy-3-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-6-methoxy-3-nitropyridin-2-amine |
| SMILES | CCCCOC[C@@H](CO[Si](C)(C)C(C)(C)C)Nc1nc(OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H35N3O5Si/c1-8-9-12-26-13-15(14-27-28(6,7)19(2,3)4)20-18-16(22(23)24)10-11-17(21-18)25-5/h10-11,15H,8-9,12-14H2,1-7H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | ANHXSVPAJSYTQA-HNNXBMFYSA-N |
| XLogP | 4.62 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|