C15H13N3O2S — CID 103964024
3-nitro-N-(2-thiophen-3-ylethyl)quinolin-4-amine (PubChem CID 103964024) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-nitro-N-(2-thiophen-3-ylethyl)quinolin-4-amine.
| Compound Name | 3-nitro-N-(2-thiophen-3-ylethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 103964024 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 3-nitro-N-(2-thiophen-3-ylethyl)quinolin-4-amine |
| SMILES | O=[N+]([O-])c1cnc2ccccc2c1NCCc1ccsc1 |
| InChI | InChI=1S/C15H13N3O2S/c19-18(20)14-9-17-13-4-2-1-3-12(13)15(14)16-7-5-11-6-8-21-10-11/h1-4,6,8-10H,5,7H2,(H,16,17) |
| InChIKey | NZPAXHSKJKOGKE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|