C9H8N2O3S — CID 21281700
2-ethyl-5-nitro-1,2-benzothiazol-3-one (PubChem CID 21281700) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-ethyl-5-nitro-1,2-benzothiazol-3-one.
| Compound Name | 2-ethyl-5-nitro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 21281700 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-ethyl-5-nitro-1,2-benzothiazol-3-one |
| SMILES | CCn1sc2ccc([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C9H8N2O3S/c1-2-10-9(12)7-5-6(11(13)14)3-4-8(7)15-10/h3-5H,2H2,1H3 |
| InChIKey | PARJDKVENWLGLN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|