C7H8Br2ClN3O3 — CID 3502850
1-(2,3-dibromo-3-chlorobutyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 3502850) has the molecular formula C7H8Br2ClN3O3 and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-(2,3-dibromo-3-chlorobutyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(2,3-dibromo-3-chlorobutyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3502850 |
| Molecular Formula | C7H8Br2ClN3O3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 374.86 |
| IUPAC Name | 1-(2,3-dibromo-3-chlorobutyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(Cl)(Br)C(Br)Cn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H8Br2ClN3O3/c1-7(9,10)3(8)2-13-5(15)11-4(14)12-6(13)16/h3H,2H2,1H3,(H2,11,12,14,15,16) |
| InChIKey | BYJCJXXTLCCIAM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|