About magnesium;1-(1-decoxyhexoxy)decane;bromide
magnesium;1-(1-decoxyhexoxy)decane;bromide (PubChem CID 165175041) has the molecular formula C26H53BrMgO2
and a molecular weight of 501.92 g/mol. Its IUPAC name is magnesium;1-(1-decoxyhexoxy)decane;bromide.
Molecular Properties
| Compound Name | magnesium;1-(1-decoxyhexoxy)decane;bromide |
| PubChem CID | 165175041 |
| Molecular Formula | C26H53BrMgO2 |
| Molecular Weight | 501.92 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | magnesium;1-(1-decoxyhexoxy)decane;bromide |
| SMILES | [Br-].[CH2-]CCCCC(OCCCCCCCCCC)OCCCCCCCCCC.[Mg+2] |
| InChI | InChI=1S/C26H53O2.BrH.Mg/c1-4-7-10-12-14-16-18-21-24-27-26(23-20-9-6-3)28-25-22-19-17-15-13-11-8-5-2;;/h26H,3-25H2,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | RLCLITLOYNXXAC-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze magnesium;1-(1-decoxyhexoxy)decane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;1-(1-decoxyhexoxy)decane;bromide?
The IUPAC name of magnesium;1-(1-decoxyhexoxy)decane;bromide (CID 165175041) is magnesium;1-(1-decoxyhexoxy)decane;bromide.
What is the SMILES notation for magnesium;1-(1-decoxyhexoxy)decane;bromide?
The canonical SMILES for magnesium;1-(1-decoxyhexoxy)decane;bromide is [Br-].[CH2-]CCCCC(OCCCCCCCCCC)OCCCCCCCCCC.[Mg+2].
What is the InChIKey of magnesium;1-(1-decoxyhexoxy)decane;bromide?
The InChIKey is RLCLITLOYNXXAC-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H53O2.BrH.Mg/c1-4-7-10-12-14-16-18-21-24-27-26(23-20-9-6-3)28-25-22-19-17-15-13-11-8-5-2;;/h26H,3-25H2,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;1-(1-decoxyhexoxy)decane;bromide?
magnesium;1-(1-decoxyhexoxy)decane;bromide has a molecular weight of 501.92 g/mol, XLogP of 5.64, 24 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;1-(1-decoxyhexoxy)decane;bromide is sourced from PubChem (CID 165175041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).