C11H24O5 — CID 57074881
3-(2-butoxy-1-ethoxyethoxy)propane-1,2-diol (PubChem CID 57074881) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(2-butoxy-1-ethoxyethoxy)propane-1,2-diol.
| Compound Name | 3-(2-butoxy-1-ethoxyethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 57074881 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-(2-butoxy-1-ethoxyethoxy)propane-1,2-diol |
| SMILES | CCCCOCC(OCC)OCC(O)CO |
| InChI | InChI=1S/C11H24O5/c1-3-5-6-14-9-11(15-4-2)16-8-10(13)7-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | LCPAOLFGFOHGRK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|