C16H32Br2O9 — CID 174221710
2-[2-[2-[1-bromo-2-[2-bromo-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 174221710) has the molecular formula C16H32Br2O9 and a molecular weight of 528.23 g/mol. Its IUPAC name is 2-[2-[2-[1-bromo-2-[2-bromo-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[1-bromo-2-[2-bromo-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 174221710 |
| Molecular Formula | C16H32Br2O9 |
| Molecular Weight | 528.23 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 2-[2-[2-[1-bromo-2-[2-bromo-2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOC(Br)COCC(Br)OCCOCCOCCO |
| InChI | InChI=1S/C16H32Br2O9/c17-15(26-11-9-23-7-5-21-3-1-19)13-25-14-16(18)27-12-10-24-8-6-22-4-2-20/h15-16,19-20H,1-14H2 |
| InChIKey | ATZMEXBGBLMPGZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|