C12H26N4O8 — CID 123489894
3-[2-(3-amino-3-hydroxyiminopropoxy)-3,4,5,6-tetrahydroxyhexoxy]-N'-hydroxypropanimidamide (PubChem CID 123489894) has the molecular formula C12H26N4O8 and a molecular weight of 354.36 g/mol. Its IUPAC name is 3-[2-(3-amino-3-hydroxyiminopropoxy)-3,4,5,6-tetrahydroxyhexoxy]-N'-hydroxypropanimidamide.
| Compound Name | 3-[2-(3-amino-3-hydroxyiminopropoxy)-3,4,5,6-tetrahydroxyhexoxy]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 123489894 |
| Molecular Formula | C12H26N4O8 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[2-(3-amino-3-hydroxyiminopropoxy)-3,4,5,6-tetrahydroxyhexoxy]-N'-hydroxypropanimidamide |
| SMILES | NC(CCOCC(OCCC(N)=NO)C(O)C(O)C(O)CO)=NO |
| InChI | InChI=1S/C12H26N4O8/c13-9(15-21)1-3-23-6-8(24-4-2-10(14)16-22)12(20)11(19)7(18)5-17/h7-8,11-12,17-22H,1-6H2,(H2,13,15)(H2,14,16) |
| InChIKey | GEEPKHRBNJGISI-UHFFFAOYSA-N |
| XLogP | -3.26 |
| TPSA | 216.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|