C11H24N4O7 — CID 123193325
3-[4-(3-amino-3-hydroxyiminopropoxy)-2,3,5-trihydroxypentoxy]-N'-hydroxypropanimidamide (PubChem CID 123193325) has the molecular formula C11H24N4O7 and a molecular weight of 324.33 g/mol. Its IUPAC name is 3-[4-(3-amino-3-hydroxyiminopropoxy)-2,3,5-trihydroxypentoxy]-N'-hydroxypropanimidamide.
| Compound Name | 3-[4-(3-amino-3-hydroxyiminopropoxy)-2,3,5-trihydroxypentoxy]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 123193325 |
| Molecular Formula | C11H24N4O7 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[4-(3-amino-3-hydroxyiminopropoxy)-2,3,5-trihydroxypentoxy]-N'-hydroxypropanimidamide |
| SMILES | NC(CCOCC(O)C(O)C(CO)OCCC(N)=NO)=NO |
| InChI | InChI=1S/C11H24N4O7/c12-9(14-19)1-3-21-6-7(17)11(18)8(5-16)22-4-2-10(13)15-20/h7-8,11,16-20H,1-6H2,(H2,12,14)(H2,13,15) |
| InChIKey | QJSXRXYFLKPRSL-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 196.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|