C18H38N8O10 — CID 123534499
N'-hydroxy-3-[3,4,5-tris(3-amino-3-hydroxyiminopropoxy)-2,6-dihydroxyhexoxy]propanimidamide (PubChem CID 123534499) has the molecular formula C18H38N8O10 and a molecular weight of 526.55 g/mol. Its IUPAC name is N'-hydroxy-3-[3,4,5-tris(3-amino-3-hydroxyiminopropoxy)-2,6-dihydroxyhexoxy]propanimidamide.
| Compound Name | N'-hydroxy-3-[3,4,5-tris(3-amino-3-hydroxyiminopropoxy)-2,6-dihydroxyhexoxy]propanimidamide |
|---|---|
| PubChem CID | 123534499 |
| Molecular Formula | C18H38N8O10 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | N'-hydroxy-3-[3,4,5-tris(3-amino-3-hydroxyiminopropoxy)-2,6-dihydroxyhexoxy]propanimidamide |
| SMILES | NC(CCOCC(O)C(OCCC(N)=NO)C(OCCC(N)=NO)C(CO)OCCC(N)=NO)=NO |
| InChI | InChI=1S/C18H38N8O10/c19-13(23-29)1-5-33-10-11(28)17(35-7-3-15(21)25-31)18(36-8-4-16(22)26-32)12(9-27)34-6-2-14(20)24-30/h11-12,17-18,27-32H,1-10H2,(H2,19,23)(H2,20,24)(H2,21,25)(H2,22,26) |
| InChIKey | JOGKXTQRJIQZRT-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 311.82 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|