C10H23O12P — CID 91851104
[(2R,3S,4S)-2,3,4,5-tetrahydroxypentyl] [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] hydrogen phosphate (PubChem CID 91851104) has the molecular formula C10H23O12P and a molecular weight of 366.26 g/mol. Its IUPAC name is [(2R,3S,4S)-2,3,4,5-tetrahydroxypentyl] [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] hydrogen phosphate.
| Compound Name | [(2R,3S,4S)-2,3,4,5-tetrahydroxypentyl] [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 91851104 |
| Molecular Formula | C10H23O12P |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | [(2R,3S,4S)-2,3,4,5-tetrahydroxypentyl] [(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl] hydrogen phosphate |
| SMILES | O=P(O)(OC[C@@H](O)[C@@H](O)[C@@H](O)CO)OC[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H23O12P/c11-1-5(13)9(17)7(15)3-21-23(19,20)22-4-8(16)10(18)6(14)2-12/h5-18H,1-4H2,(H,19,20)/t5-,6+,7+,8-,9-,10+ |
| InChIKey | DNMIGQPMWSUBNJ-UXAOAXNSSA-N |
| XLogP | -4.73 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|