C12H24NO13P — CID 18665423
[(2R,3R,4R,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] hydrogen phosphate (PubChem CID 18665423) has the molecular formula C12H24NO13P and a molecular weight of 421.29 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 18665423 |
| Molecular Formula | C12H24NO13P |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | [(2R,3R,4R,5R)-2-amino-4,5,6-trihydroxy-1-oxohexan-3-yl] [(2R,3R,4S)-2,3,4,6-tetrahydroxy-5-oxohexyl] hydrogen phosphate |
| SMILES | N[C@@H](C=O)[C@@H](OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)CO)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H24NO13P/c13-5(1-14)12(11(22)7(18)3-16)26-27(23,24)25-4-8(19)10(21)9(20)6(17)2-15/h1,5,7-12,15-16,18-22H,2-4,13H2,(H,23,24)/t5-,7+,8+,9+,10+,11+,12+/m0/s1 |
| InChIKey | KKQXESRLGMCVSF-CHZZXXEHSA-N |
| XLogP | -5.63 |
| TPSA | 257.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|