C12H23O16PZn — CID 175106834
zinc;2,3,4,5,6-pentahydroxyhexanoate;(2,3,4,6-tetrahydroxy-5-oxohexyl) hydrogen phosphate (PubChem CID 175106834) has the molecular formula C12H23O16PZn and a molecular weight of 519.66 g/mol. Its IUPAC name is zinc;2,3,4,5,6-pentahydroxyhexanoate;(2,3,4,6-tetrahydroxy-5-oxohexyl) hydrogen phosphate.
| Compound Name | zinc;2,3,4,5,6-pentahydroxyhexanoate;(2,3,4,6-tetrahydroxy-5-oxohexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 175106834 |
| Molecular Formula | C12H23O16PZn |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | zinc;2,3,4,5,6-pentahydroxyhexanoate;(2,3,4,6-tetrahydroxy-5-oxohexyl) hydrogen phosphate |
| SMILES | O=C(CO)C(O)C(O)C(O)COP(=O)([O-])O.O=C([O-])C(O)C(O)C(O)C(O)CO.[Zn+2] |
| InChI | InChI=1S/C6H13O9P.C6H12O7.Zn/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;7-1-2(8)3(9)4(10)5(11)6(12)13;/h4-7,9-11H,1-2H2,(H2,12,13,14);2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2 |
| InChIKey | VRVZVHIOJHQKDV-UHFFFAOYSA-L |
| XLogP | -8.72 |
| TPSA | 308.86 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | -8.72 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|