C4H13N4S+ — CID 159951875
[amino(methylsulfanyl)methylidene]azanium;ethene-1,1-diamine (PubChem CID 159951875) has the molecular formula C4H13N4S+ and a molecular weight of 149.24 g/mol. Its IUPAC name is [amino(methylsulfanyl)methylidene]azanium;ethene-1,1-diamine.
| Compound Name | [amino(methylsulfanyl)methylidene]azanium;ethene-1,1-diamine |
|---|---|
| PubChem CID | 159951875 |
| Molecular Formula | C4H13N4S+ |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.09 |
| IUPAC Name | [amino(methylsulfanyl)methylidene]azanium;ethene-1,1-diamine |
| SMILES | C=C(N)N.CSC(N)=[NH2+] |
| InChI | InChI=1S/C2H6N2S.C2H6N2/c1-5-2(3)4;1-2(3)4/h1H3,(H3,3,4);1,3-4H2/p+1 |
| InChIKey | OCFJJQYWNGMUGY-UHFFFAOYSA-O |
| XLogP | -2.20 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|