C8H15N3OS — CID 174250512
(E)-3-amino-2-(hydroxymethyl)-N'-(1-methylsulfanylethenyl)but-2-enimidamide (PubChem CID 174250512) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is (E)-3-amino-2-(hydroxymethyl)-N'-(1-methylsulfanylethenyl)but-2-enimidamide.
| Compound Name | (E)-3-amino-2-(hydroxymethyl)-N'-(1-methylsulfanylethenyl)but-2-enimidamide |
|---|---|
| PubChem CID | 174250512 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (E)-3-amino-2-(hydroxymethyl)-N'-(1-methylsulfanylethenyl)but-2-enimidamide |
| SMILES | C=C(N=C(N)/C(CO)=C(/C)N)SC |
| InChI | InChI=1S/C8H15N3OS/c1-5(9)7(4-12)8(10)11-6(2)13-3/h12H,2,4,9H2,1,3H3,(H2,10,11)/b7-5- |
| InChIKey | DYSHXMGHBUCZPD-ALCCZGGFSA-N |
| XLogP | 0.40 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|