C8H16N2O — CID 171065813
(Z)-4-amino-3-(C,N-dimethylcarbonimidoyl)pent-3-en-1-ol (PubChem CID 171065813) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is (Z)-4-amino-3-(C,N-dimethylcarbonimidoyl)pent-3-en-1-ol.
| Compound Name | (Z)-4-amino-3-(C,N-dimethylcarbonimidoyl)pent-3-en-1-ol |
|---|---|
| PubChem CID | 171065813 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (Z)-4-amino-3-(C,N-dimethylcarbonimidoyl)pent-3-en-1-ol |
| SMILES | C/N=C(C)/C(CCO)=C(/C)N |
| InChI | InChI=1S/C8H16N2O/c1-6(9)8(4-5-11)7(2)10-3/h11H,4-5,9H2,1-3H3/b8-6-,10-7+ |
| InChIKey | FFDVJFDTXYNWAB-GOOBONSCSA-N |
| XLogP | 0.69 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|