C6H14N2NiO2 — CID 20647692
2-N,3-N-dimethylbutane-2,3-diimine;hydrogen peroxide;nickel (PubChem CID 20647692) has the molecular formula C6H14N2NiO2 and a molecular weight of 204.88 g/mol. Its IUPAC name is 2-N,3-N-dimethylbutane-2,3-diimine;hydrogen peroxide;nickel.
| Compound Name | 2-N,3-N-dimethylbutane-2,3-diimine;hydrogen peroxide;nickel |
|---|---|
| PubChem CID | 20647692 |
| Molecular Formula | C6H14N2NiO2 |
| Molecular Weight | 204.88 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 2-N,3-N-dimethylbutane-2,3-diimine;hydrogen peroxide;nickel |
| SMILES | C/N=C(C)/C(C)=N/C.OO.[Ni] |
| InChI | InChI=1S/C6H12N2.Ni.H2O2/c1-5(7-3)6(2)8-4;;1-2/h1-4H3;;1-2H/b7-5+,8-6+;; |
| InChIKey | VADHHUNTKDNJBG-ZHINHYBUSA-N |
| XLogP | 1.18 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.88 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|