C8H13NS — CID 146552473
(3Z)-4-methyl-3-(methylaminomethylidene)penta-1,4-diene-2-thiol (PubChem CID 146552473) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is (3Z)-4-methyl-3-(methylaminomethylidene)penta-1,4-diene-2-thiol.
| Compound Name | (3Z)-4-methyl-3-(methylaminomethylidene)penta-1,4-diene-2-thiol |
|---|---|
| PubChem CID | 146552473 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | (3Z)-4-methyl-3-(methylaminomethylidene)penta-1,4-diene-2-thiol |
| SMILES | C=C(C)/C(=C/NC)C(=C)S |
| InChI | InChI=1S/C8H13NS/c1-6(2)8(5-9-4)7(3)10/h5,9-10H,1,3H2,2,4H3/b8-5- |
| InChIKey | IXGGZVRFDJAOKY-YVMONPNESA-N |
| XLogP | 2.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|