C12H22N2 — CID 170244413
(1Z)-1-N,2-N,4-trimethyl-3-methylidene-2-N-propan-2-ylpenta-1,4-diene-1,2-diamine (PubChem CID 170244413) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (1Z)-1-N,2-N,4-trimethyl-3-methylidene-2-N-propan-2-ylpenta-1,4-diene-1,2-diamine.
| Compound Name | (1Z)-1-N,2-N,4-trimethyl-3-methylidene-2-N-propan-2-ylpenta-1,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 170244413 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (1Z)-1-N,2-N,4-trimethyl-3-methylidene-2-N-propan-2-ylpenta-1,4-diene-1,2-diamine |
| SMILES | C=C(C)C(=C)/C(=C/NC)N(C)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-9(2)11(5)12(8-13-6)14(7)10(3)4/h8,10,13H,1,5H2,2-4,6-7H3/b12-8- |
| InChIKey | WJISOMPCYBJPPB-WQLSENKSSA-N |
| XLogP | 2.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|