C9H16N2OS — CID 143029558
(Z,2Z)-3-methyl-2-(methylaminomethylidene)-4-sulfanylhex-3-enamide (PubChem CID 143029558) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is (Z,2Z)-3-methyl-2-(methylaminomethylidene)-4-sulfanylhex-3-enamide.
| Compound Name | (Z,2Z)-3-methyl-2-(methylaminomethylidene)-4-sulfanylhex-3-enamide |
|---|---|
| PubChem CID | 143029558 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (Z,2Z)-3-methyl-2-(methylaminomethylidene)-4-sulfanylhex-3-enamide |
| SMILES | CC/C(S)=C(C)/C(=C/NC)C(N)=O |
| InChI | InChI=1S/C9H16N2OS/c1-4-8(13)6(2)7(5-11-3)9(10)12/h5,11,13H,4H2,1-3H3,(H2,10,12)/b7-5-,8-6- |
| InChIKey | PAOWXHAQYNBDMZ-SFECMWDFSA-N |
| XLogP | 1.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|