C5H10N2S — CID 126635760
(1E,3Z)-2-amino-4-(methylamino)buta-1,3-diene-1-thiol (PubChem CID 126635760) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is (1E,3Z)-2-amino-4-(methylamino)buta-1,3-diene-1-thiol.
| Compound Name | (1E,3Z)-2-amino-4-(methylamino)buta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 126635760 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (1E,3Z)-2-amino-4-(methylamino)buta-1,3-diene-1-thiol |
| SMILES | CN/C=C\C(N)=C/S |
| InChI | InChI=1S/C5H10N2S/c1-7-3-2-5(6)4-8/h2-4,7-8H,6H2,1H3/b3-2-,5-4+ |
| InChIKey | KBTUVZJNFHVJAS-AWYLAFAOSA-N |
| XLogP | 0.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|