C5H11N3 — CID 137384299
(1E,3Z)-2-N-methylbuta-1,3-diene-1,2,4-triamine (PubChem CID 137384299) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is (1E,3Z)-2-N-methylbuta-1,3-diene-1,2,4-triamine.
| Compound Name | (1E,3Z)-2-N-methylbuta-1,3-diene-1,2,4-triamine |
|---|---|
| PubChem CID | 137384299 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (1E,3Z)-2-N-methylbuta-1,3-diene-1,2,4-triamine |
| SMILES | CNC(/C=C\N)=C/N |
| InChI | InChI=1S/C5H11N3/c1-8-5(4-7)2-3-6/h2-4,8H,6-7H2,1H3/b3-2-,5-4+ |
| InChIKey | SCVTXGGUDNKQFC-AWYLAFAOSA-N |
| XLogP | -0.52 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|