C10H15FN2 — CID 137466729
(2E,4Z,6Z)-2-N-ethenyl-4-fluoroocta-2,4,6-triene-2,5-diamine (PubChem CID 137466729) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is (2E,4Z,6Z)-2-N-ethenyl-4-fluoroocta-2,4,6-triene-2,5-diamine.
| Compound Name | (2E,4Z,6Z)-2-N-ethenyl-4-fluoroocta-2,4,6-triene-2,5-diamine |
|---|---|
| PubChem CID | 137466729 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | (2E,4Z,6Z)-2-N-ethenyl-4-fluoroocta-2,4,6-triene-2,5-diamine |
| SMILES | C=CN/C(C)=C/C(F)=C(N)\C=C/C |
| InChI | InChI=1S/C10H15FN2/c1-4-6-10(12)9(11)7-8(3)13-5-2/h4-7,13H,2,12H2,1,3H3/b6-4-,8-7+,10-9- |
| InChIKey | FPOLEUUTGSMJHS-QGPBFCFOSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|