C6H9FN2 — CID 89025484
(1E,3Z)-5-fluorohexa-1,3,5-triene-1,2-diamine (PubChem CID 89025484) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is (1E,3Z)-5-fluorohexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1E,3Z)-5-fluorohexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 89025484 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (1E,3Z)-5-fluorohexa-1,3,5-triene-1,2-diamine |
| SMILES | C=C(F)/C=C\C(N)=C/N |
| InChI | InChI=1S/C6H9FN2/c1-5(7)2-3-6(9)4-8/h2-4H,1,8-9H2/b3-2-,6-4+ |
| InChIKey | WFYMSOORCHDDHX-MGLVMYNNSA-N |
| XLogP | 0.78 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|