C8H13FN2 — CID 130256401
(1E,3E)-4-fluoro-1-N,1-N-dimethylhexa-1,3,5-triene-1,2-diamine (PubChem CID 130256401) has the molecular formula C8H13FN2 and a molecular weight of 156.20 g/mol. Its IUPAC name is (1E,3E)-4-fluoro-1-N,1-N-dimethylhexa-1,3,5-triene-1,2-diamine.
| Compound Name | (1E,3E)-4-fluoro-1-N,1-N-dimethylhexa-1,3,5-triene-1,2-diamine |
|---|---|
| PubChem CID | 130256401 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | (1E,3E)-4-fluoro-1-N,1-N-dimethylhexa-1,3,5-triene-1,2-diamine |
| SMILES | C=C/C(F)=C\C(N)=C/N(C)C |
| InChI | InChI=1S/C8H13FN2/c1-4-7(9)5-8(10)6-11(2)3/h4-6H,1,10H2,2-3H3/b7-5+,8-6+ |
| InChIKey | HIQQUFIKRJWNJL-KQQUZDAGSA-N |
| XLogP | 1.39 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|