C9H15FN2 — CID 126490173
(1Z,3Z)-4-fluoro-1-N,3-N,3-N-trimethylhexa-1,3,5-triene-1,3-diamine (PubChem CID 126490173) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is (1Z,3Z)-4-fluoro-1-N,3-N,3-N-trimethylhexa-1,3,5-triene-1,3-diamine.
| Compound Name | (1Z,3Z)-4-fluoro-1-N,3-N,3-N-trimethylhexa-1,3,5-triene-1,3-diamine |
|---|---|
| PubChem CID | 126490173 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | (1Z,3Z)-4-fluoro-1-N,3-N,3-N-trimethylhexa-1,3,5-triene-1,3-diamine |
| SMILES | C=C/C(F)=C(\C=C/NC)N(C)C |
| InChI | InChI=1S/C9H15FN2/c1-5-8(10)9(12(3)4)6-7-11-2/h5-7,11H,1H2,2-4H3/b7-6-,9-8- |
| InChIKey | YVBWERMFFRTELH-JPDBVBESSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|