C9H14F2N2 — CID 163675939
(Z)-N-(3-fluorobuta-1,3-dien-2-yl)-N'-(2-fluoroethyl)-N'-methylethene-1,2-diamine (PubChem CID 163675939) has the molecular formula C9H14F2N2 and a molecular weight of 188.22 g/mol. Its IUPAC name is (Z)-N-(3-fluorobuta-1,3-dien-2-yl)-N'-(2-fluoroethyl)-N'-methylethene-1,2-diamine.
| Compound Name | (Z)-N-(3-fluorobuta-1,3-dien-2-yl)-N'-(2-fluoroethyl)-N'-methylethene-1,2-diamine |
|---|---|
| PubChem CID | 163675939 |
| Molecular Formula | C9H14F2N2 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (Z)-N-(3-fluorobuta-1,3-dien-2-yl)-N'-(2-fluoroethyl)-N'-methylethene-1,2-diamine |
| SMILES | C=C(F)C(=C)N/C=C\N(C)CCF |
| InChI | InChI=1S/C9H14F2N2/c1-8(11)9(2)12-5-7-13(3)6-4-10/h5,7,12H,1-2,4,6H2,3H3/b7-5- |
| InChIKey | JGRZWNMIRRUWEM-ALCCZGGFSA-N |
| XLogP | 1.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|