C6H8FN — CID 129196450
(1Z,3E)-4-fluorohexa-1,3,5-trien-1-amine (PubChem CID 129196450) has the molecular formula C6H8FN and a molecular weight of 113.13 g/mol. Its IUPAC name is (1Z,3E)-4-fluorohexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E)-4-fluorohexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129196450 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | (1Z,3E)-4-fluorohexa-1,3,5-trien-1-amine |
| SMILES | C=C/C(F)=C\C=C/N |
| InChI | InChI=1S/C6H8FN/c1-2-6(7)4-3-5-8/h2-5H,1,8H2/b5-3-,6-4+ |
| InChIKey | QKHFXADNQWBJPR-CIIODKQPSA-N |
| XLogP | 1.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|